C22H22N4O3 — CID 3404924
14-imino-11-(3-methoxyphenyl)-12,13-dioxatricyclo[7.3.2.01,8]tetradecane-9,10,10-tricarbonitrile (PubChem CID 3404924) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is 14-imino-11-(3-methoxyphenyl)-12,13-dioxatricyclo[7.3.2.01,8]tetradecane-9,10,10-tricarbonitrile.
| Compound Name | 14-imino-11-(3-methoxyphenyl)-12,13-dioxatricyclo[7.3.2.01,8]tetradecane-9,10,10-tricarbonitrile |
|---|---|
| PubChem CID | 3404924 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 14-imino-11-(3-methoxyphenyl)-12,13-dioxatricyclo[7.3.2.01,8]tetradecane-9,10,10-tricarbonitrile |
| SMILES | [H]/N=C1/OC23CCCCCCC2C1(C#N)C(C#N)(C#N)C(c1cccc(OC)c1)O3 |
| InChI | InChI=1S/C22H22N4O3/c1-27-16-8-6-7-15(11-16)18-20(12-23,13-24)21(14-25)17-9-4-2-3-5-10-22(17,28-18)29-19(21)26/h6-8,11,17-18,26H,2-5,9-10H2,1H3/b26-19+ |
| InChIKey | YZFCAJFKOIQYEC-LGUFXXKBSA-N |
| XLogP | 3.98 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|