C28H26Cl2N4O3 — CID 4628096
1-(2,4-dichlorophenyl)-3-(4-hexoxyphenyl)-6-imino-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile (PubChem CID 4628096) has the molecular formula C28H26Cl2N4O3 and a molecular weight of 537.45 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-(4-hexoxyphenyl)-6-imino-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile.
| Compound Name | 1-(2,4-dichlorophenyl)-3-(4-hexoxyphenyl)-6-imino-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
|---|---|
| PubChem CID | 4628096 |
| Molecular Formula | C28H26Cl2N4O3 |
| Molecular Weight | 537.45 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-(4-hexoxyphenyl)-6-imino-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
| SMILES | [H]/N=C1\OC2(c3ccc(Cl)cc3Cl)OC(c3ccc(OCCCCCC)cc3)C(C#N)(C#N)C1(C#N)C2C |
| InChI | InChI=1S/C28H26Cl2N4O3/c1-3-4-5-6-13-35-21-10-7-19(8-11-21)24-26(15-31,16-32)27(17-33)18(2)28(36-24,37-25(27)34)22-12-9-20(29)14-23(22)30/h7-12,14,18,24,34H,3-6,13H2,1-2H3/b34-25- |
| InChIKey | SZHKBPIQXIKDOI-NQUVTRGKSA-N |
| XLogP | 7.06 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.45 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|