C28H18Cl2N4O3 — CID 4628103
1-(2,4-dichlorophenyl)-6-imino-8-methyl-3-(3-phenoxyphenyl)-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile (PubChem CID 4628103) has the molecular formula C28H18Cl2N4O3 and a molecular weight of 529.38 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-6-imino-8-methyl-3-(3-phenoxyphenyl)-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile.
| Compound Name | 1-(2,4-dichlorophenyl)-6-imino-8-methyl-3-(3-phenoxyphenyl)-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
|---|---|
| PubChem CID | 4628103 |
| Molecular Formula | C28H18Cl2N4O3 |
| Molecular Weight | 529.38 g/mol |
| Exact Mass | 528.08 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-6-imino-8-methyl-3-(3-phenoxyphenyl)-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
| SMILES | [H]/N=C1\OC2(c3ccc(Cl)cc3Cl)OC(c3cccc(Oc4ccccc4)c3)C(C#N)(C#N)C1(C#N)C2C |
| InChI | InChI=1S/C28H18Cl2N4O3/c1-17-27(16-33)25(34)37-28(17,22-11-10-19(29)13-23(22)30)36-24(26(27,14-31)15-32)18-6-5-9-21(12-18)35-20-7-3-2-4-8-20/h2-13,17,24,34H,1H3/b34-25- |
| InChIKey | XSYPZEJONSXUEK-NQUVTRGKSA-N |
| XLogP | 6.90 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.38 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|