C24H19ClN4O4 — CID 3498574
1-(4-chlorophenyl)-3-(2,3-dimethoxyphenyl)-6-imino-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile (PubChem CID 3498574) has the molecular formula C24H19ClN4O4 and a molecular weight of 462.89 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(2,3-dimethoxyphenyl)-6-imino-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile.
| Compound Name | 1-(4-chlorophenyl)-3-(2,3-dimethoxyphenyl)-6-imino-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
|---|---|
| PubChem CID | 3498574 |
| Molecular Formula | C24H19ClN4O4 |
| Molecular Weight | 462.89 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(2,3-dimethoxyphenyl)-6-imino-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
| SMILES | [H]/N=C1\OC2(c3ccc(Cl)cc3)OC(c3cccc(OC)c3OC)C(C#N)(C#N)C1(C#N)C2C |
| InChI | InChI=1S/C24H19ClN4O4/c1-14-23(13-28)21(29)33-24(14,15-7-9-16(25)10-8-15)32-20(22(23,11-26)12-27)17-5-4-6-18(30-2)19(17)31-3/h4-10,14,20,29H,1-3H3/b29-21- |
| InChIKey | ZKDRYOSVBLMTCU-ANYBSYGZSA-N |
| XLogP | 4.47 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.89 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|