C23H16Cl2N4O2 — CID 3363748
3-(2,3-dichlorophenyl)-6-imino-8-methyl-1-(4-methylphenyl)-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile (PubChem CID 3363748) has the molecular formula C23H16Cl2N4O2 and a molecular weight of 451.31 g/mol. Its IUPAC name is 3-(2,3-dichlorophenyl)-6-imino-8-methyl-1-(4-methylphenyl)-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile.
| Compound Name | 3-(2,3-dichlorophenyl)-6-imino-8-methyl-1-(4-methylphenyl)-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
|---|---|
| PubChem CID | 3363748 |
| Molecular Formula | C23H16Cl2N4O2 |
| Molecular Weight | 451.31 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | 3-(2,3-dichlorophenyl)-6-imino-8-methyl-1-(4-methylphenyl)-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
| SMILES | [H]/N=C1\OC2(c3ccc(C)cc3)OC(c3cccc(Cl)c3Cl)C(C#N)(C#N)C1(C#N)C2C |
| InChI | InChI=1S/C23H16Cl2N4O2/c1-13-6-8-15(9-7-13)23-14(2)22(12-28,20(29)31-23)21(10-26,11-27)19(30-23)16-4-3-5-17(24)18(16)25/h3-9,14,19,29H,1-2H3/b29-20- |
| InChIKey | BXZGPSCMEUFRQV-BRPDVVIDSA-N |
| XLogP | 5.41 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.31 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|