C24H19BrN4O2 — CID 4627287
1-(4-bromophenyl)-3-(2,4-dimethylphenyl)-6-imino-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile (PubChem CID 4627287) has the molecular formula C24H19BrN4O2 and a molecular weight of 475.35 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-(2,4-dimethylphenyl)-6-imino-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile.
| Compound Name | 1-(4-bromophenyl)-3-(2,4-dimethylphenyl)-6-imino-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
|---|---|
| PubChem CID | 4627287 |
| Molecular Formula | C24H19BrN4O2 |
| Molecular Weight | 475.35 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | 1-(4-bromophenyl)-3-(2,4-dimethylphenyl)-6-imino-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
| SMILES | [H]/N=C1\OC2(c3ccc(Br)cc3)OC(c3ccc(C)cc3C)C(C#N)(C#N)C1(C#N)C2C |
| InChI | InChI=1S/C24H19BrN4O2/c1-14-4-9-19(15(2)10-14)20-22(11-26,12-27)23(13-28)16(3)24(30-20,31-21(23)29)17-5-7-18(25)8-6-17/h4-10,16,20,29H,1-3H3/b29-21- |
| InChIKey | TTZAIYYPOZLZGY-ANYBSYGZSA-N |
| XLogP | 5.18 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.35 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|