C21H14BrN5O2 — CID 4626982
1-(4-bromophenyl)-6-imino-8-methyl-3-pyridin-3-yl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile (PubChem CID 4626982) has the molecular formula C21H14BrN5O2 and a molecular weight of 448.28 g/mol. Its IUPAC name is 1-(4-bromophenyl)-6-imino-8-methyl-3-pyridin-3-yl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile.
| Compound Name | 1-(4-bromophenyl)-6-imino-8-methyl-3-pyridin-3-yl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
|---|---|
| PubChem CID | 4626982 |
| Molecular Formula | C21H14BrN5O2 |
| Molecular Weight | 448.28 g/mol |
| Exact Mass | 447.03 |
| IUPAC Name | 1-(4-bromophenyl)-6-imino-8-methyl-3-pyridin-3-yl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
| SMILES | [H]/N=C1\OC2(c3ccc(Br)cc3)OC(c3cccnc3)C(C#N)(C#N)C1(C#N)C2C |
| InChI | InChI=1S/C21H14BrN5O2/c1-13-20(12-25)18(26)29-21(13,15-4-6-16(22)7-5-15)28-17(19(20,10-23)11-24)14-3-2-8-27-9-14/h2-9,13,17,26H,1H3/b26-18- |
| InChIKey | QLEMSCPEWUUNIE-ITYLOYPMSA-N |
| XLogP | 3.96 |
| TPSA | 126.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.28 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|