C23H14BrN5O6 — CID 4627133
1-(4-bromophenyl)-6-imino-8-methyl-3-(6-nitro-1,3-benzodioxol-5-yl)-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile (PubChem CID 4627133) has the molecular formula C23H14BrN5O6 and a molecular weight of 536.30 g/mol. Its IUPAC name is 1-(4-bromophenyl)-6-imino-8-methyl-3-(6-nitro-1,3-benzodioxol-5-yl)-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile.
| Compound Name | 1-(4-bromophenyl)-6-imino-8-methyl-3-(6-nitro-1,3-benzodioxol-5-yl)-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
|---|---|
| PubChem CID | 4627133 |
| Molecular Formula | C23H14BrN5O6 |
| Molecular Weight | 536.30 g/mol |
| Exact Mass | 535.01 |
| IUPAC Name | 1-(4-bromophenyl)-6-imino-8-methyl-3-(6-nitro-1,3-benzodioxol-5-yl)-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
| SMILES | [H]/N=C1\OC2(c3ccc(Br)cc3)OC(c3cc4c(cc3[N+](=O)[O-])OCO4)C(C#N)(C#N)C1(C#N)C2C |
| InChI | InChI=1S/C23H14BrN5O6/c1-12-22(10-27)20(28)35-23(12,13-2-4-14(24)5-3-13)34-19(21(22,8-25)9-26)15-6-17-18(33-11-32-17)7-16(15)29(30)31/h2-7,12,19,28H,11H2,1H3/b28-20- |
| InChIKey | XOEDVSRYQOGTGW-RRAHZORUSA-N |
| XLogP | 4.20 |
| TPSA | 175.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.30 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|