C18H15BrN4O3 — CID 3393831
3-(5-bromo-2-methoxyphenyl)-6-imino-1,8-dimethyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile (PubChem CID 3393831) has the molecular formula C18H15BrN4O3 and a molecular weight of 415.25 g/mol. Its IUPAC name is 3-(5-bromo-2-methoxyphenyl)-6-imino-1,8-dimethyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile.
| Compound Name | 3-(5-bromo-2-methoxyphenyl)-6-imino-1,8-dimethyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
|---|---|
| PubChem CID | 3393831 |
| Molecular Formula | C18H15BrN4O3 |
| Molecular Weight | 415.25 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | 3-(5-bromo-2-methoxyphenyl)-6-imino-1,8-dimethyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
| SMILES | [H]/N=C1\OC2(C)OC(c3cc(Br)ccc3OC)C(C#N)(C#N)C1(C#N)C2C |
| InChI | InChI=1S/C18H15BrN4O3/c1-10-16(2)25-14(12-6-11(19)4-5-13(12)24-3)17(7-20,8-21)18(10,9-22)15(23)26-16/h4-6,10,14,23H,1-3H3/b23-15- |
| InChIKey | GVUFCCVZENERAT-HAHDFKILSA-N |
| XLogP | 3.43 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.25 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|