C25H21BrN4O3 — CID 4630402
8-benzyl-3-(5-bromo-2-ethoxyphenyl)-6-imino-1-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile (PubChem CID 4630402) has the molecular formula C25H21BrN4O3 and a molecular weight of 505.37 g/mol. Its IUPAC name is 8-benzyl-3-(5-bromo-2-ethoxyphenyl)-6-imino-1-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile.
| Compound Name | 8-benzyl-3-(5-bromo-2-ethoxyphenyl)-6-imino-1-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
|---|---|
| PubChem CID | 4630402 |
| Molecular Formula | C25H21BrN4O3 |
| Molecular Weight | 505.37 g/mol |
| Exact Mass | 504.08 |
| IUPAC Name | 8-benzyl-3-(5-bromo-2-ethoxyphenyl)-6-imino-1-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
| SMILES | [H]/N=C1\OC2(C)OC(c3cc(Br)ccc3OCC)C(C#N)(C#N)C1(C#N)C2Cc1ccccc1 |
| InChI | InChI=1S/C25H21BrN4O3/c1-3-31-19-10-9-17(26)12-18(19)21-24(13-27,14-28)25(15-29)20(11-16-7-5-4-6-8-16)23(2,32-21)33-22(25)30/h4-10,12,20-21,30H,3,11H2,1-2H3/b30-22- |
| InChIKey | YAZLTHRFJWVWCG-SWKFRHMKSA-N |
| XLogP | 5.05 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.37 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|