C17H13N5O4 — CID 100885210
(1R,3S,5R,8S)-6-imino-1,8-dimethyl-3-(4-nitrophenyl)-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile (PubChem CID 100885210) has the molecular formula C17H13N5O4 and a molecular weight of 351.32 g/mol. Its IUPAC name is (1R,3S,5R,8S)-6-imino-1,8-dimethyl-3-(4-nitrophenyl)-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile.
| Compound Name | (1R,3S,5R,8S)-6-imino-1,8-dimethyl-3-(4-nitrophenyl)-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
|---|---|
| PubChem CID | 100885210 |
| Molecular Formula | C17H13N5O4 |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | (1R,3S,5R,8S)-6-imino-1,8-dimethyl-3-(4-nitrophenyl)-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
| SMILES | [H]/N=C1\O[C@@]2(C)O[C@@H](c3ccc([N+](=O)[O-])cc3)C(C#N)(C#N)[C@@]1(C#N)[C@@H]2C |
| InChI | InChI=1S/C17H13N5O4/c1-10-15(2)25-13(11-3-5-12(6-4-11)22(23)24)16(7-18,8-19)17(10,9-20)14(21)26-15/h3-6,10,13,21H,1-2H3/b21-14-/t10-,13+,15-,17+/m1/s1 |
| InChIKey | BCTAXDDPLMJABR-CGXPKNSJSA-N |
| XLogP | 2.57 |
| TPSA | 156.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|