C17H13FN4O2 — CID 3392274
3-(2-fluorophenyl)-6-imino-1,8-dimethyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile (PubChem CID 3392274) has the molecular formula C17H13FN4O2 and a molecular weight of 324.32 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-6-imino-1,8-dimethyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile.
| Compound Name | 3-(2-fluorophenyl)-6-imino-1,8-dimethyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
|---|---|
| PubChem CID | 3392274 |
| Molecular Formula | C17H13FN4O2 |
| Molecular Weight | 324.32 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 3-(2-fluorophenyl)-6-imino-1,8-dimethyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
| SMILES | [H]/N=C1\OC2(C)OC(c3ccccc3F)C(C#N)(C#N)C1(C#N)C2C |
| InChI | InChI=1S/C17H13FN4O2/c1-10-15(2)23-13(11-5-3-4-6-12(11)18)16(7-19,8-20)17(10,9-21)14(22)24-15/h3-6,10,13,22H,1-2H3/b22-14- |
| InChIKey | RACDDJSKRLXLLG-HMAPJEAMSA-N |
| XLogP | 2.80 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|