C17H12ClFN4O2 — CID 3394519
3-(2-chloro-6-fluorophenyl)-6-imino-1,8-dimethyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile (PubChem CID 3394519) has the molecular formula C17H12ClFN4O2 and a molecular weight of 358.76 g/mol. Its IUPAC name is 3-(2-chloro-6-fluorophenyl)-6-imino-1,8-dimethyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile.
| Compound Name | 3-(2-chloro-6-fluorophenyl)-6-imino-1,8-dimethyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
|---|---|
| PubChem CID | 3394519 |
| Molecular Formula | C17H12ClFN4O2 |
| Molecular Weight | 358.76 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 3-(2-chloro-6-fluorophenyl)-6-imino-1,8-dimethyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
| SMILES | [H]/N=C1\OC2(C)OC(c3c(F)cccc3Cl)C(C#N)(C#N)C1(C#N)C2C |
| InChI | InChI=1S/C17H12ClFN4O2/c1-9-15(2)24-13(12-10(18)4-3-5-11(12)19)16(6-20,7-21)17(9,8-22)14(23)25-15/h3-5,9,13,23H,1-2H3/b23-14- |
| InChIKey | SSEWLNPHNOOMNQ-UCQKPKSFSA-N |
| XLogP | 3.45 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.76 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|