C18H21NO5 — CID 10019591
diethyl 1-acetyl-3-phenyl-3H-pyrrole-2,2-dicarboxylate (PubChem CID 10019591) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is diethyl 1-acetyl-3-phenyl-3H-pyrrole-2,2-dicarboxylate.
| Compound Name | diethyl 1-acetyl-3-phenyl-3H-pyrrole-2,2-dicarboxylate |
|---|---|
| PubChem CID | 10019591 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | diethyl 1-acetyl-3-phenyl-3H-pyrrole-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C(c2ccccc2)C=CN1C(C)=O |
| InChI | InChI=1S/C18H21NO5/c1-4-23-16(21)18(17(22)24-5-2)15(11-12-19(18)13(3)20)14-9-7-6-8-10-14/h6-12,15H,4-5H2,1-3H3 |
| InChIKey | OTWLOHSMIMPTCD-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|