C19H26N2O5 — CID 134230399
diethyl 4-(benzylamino)-1,3-dimethyl-5-oxopyrrolidine-2,2-dicarboxylate (PubChem CID 134230399) has the molecular formula C19H26N2O5 and a molecular weight of 362.43 g/mol. Its IUPAC name is diethyl 4-(benzylamino)-1,3-dimethyl-5-oxopyrrolidine-2,2-dicarboxylate.
| Compound Name | diethyl 4-(benzylamino)-1,3-dimethyl-5-oxopyrrolidine-2,2-dicarboxylate |
|---|---|
| PubChem CID | 134230399 |
| Molecular Formula | C19H26N2O5 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | diethyl 4-(benzylamino)-1,3-dimethyl-5-oxopyrrolidine-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C(C)C(NCc2ccccc2)C(=O)N1C |
| InChI | InChI=1S/C19H26N2O5/c1-5-25-17(23)19(18(24)26-6-2)13(3)15(16(22)21(19)4)20-12-14-10-8-7-9-11-14/h7-11,13,15,20H,5-6,12H2,1-4H3 |
| InChIKey | LTSTXVZNRPNUHY-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|