C20H27NO5 — CID 134349322
diethyl 1-benzyl-5-oxo-3-propan-2-ylpyrrolidine-2,2-dicarboxylate (PubChem CID 134349322) has the molecular formula C20H27NO5 and a molecular weight of 361.44 g/mol. Its IUPAC name is diethyl 1-benzyl-5-oxo-3-propan-2-ylpyrrolidine-2,2-dicarboxylate.
| Compound Name | diethyl 1-benzyl-5-oxo-3-propan-2-ylpyrrolidine-2,2-dicarboxylate |
|---|---|
| PubChem CID | 134349322 |
| Molecular Formula | C20H27NO5 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | diethyl 1-benzyl-5-oxo-3-propan-2-ylpyrrolidine-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C(C(C)C)CC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C20H27NO5/c1-5-25-18(23)20(19(24)26-6-2)16(14(3)4)12-17(22)21(20)13-15-10-8-7-9-11-15/h7-11,14,16H,5-6,12-13H2,1-4H3 |
| InChIKey | CLPLBCLXVUSZOD-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|