C24H25NO6 — CID 162905315
diethyl (3S)-3-benzoyl-1-(4-methylphenyl)-5-oxopyrrolidine-2,2-dicarboxylate (PubChem CID 162905315) has the molecular formula C24H25NO6 and a molecular weight of 423.47 g/mol. Its IUPAC name is diethyl (3S)-3-benzoyl-1-(4-methylphenyl)-5-oxopyrrolidine-2,2-dicarboxylate.
| Compound Name | diethyl (3S)-3-benzoyl-1-(4-methylphenyl)-5-oxopyrrolidine-2,2-dicarboxylate |
|---|---|
| PubChem CID | 162905315 |
| Molecular Formula | C24H25NO6 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | diethyl (3S)-3-benzoyl-1-(4-methylphenyl)-5-oxopyrrolidine-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)[C@@H](C(=O)c2ccccc2)CC(=O)N1c1ccc(C)cc1 |
| InChI | InChI=1S/C24H25NO6/c1-4-30-22(28)24(23(29)31-5-2)19(21(27)17-9-7-6-8-10-17)15-20(26)25(24)18-13-11-16(3)12-14-18/h6-14,19H,4-5,15H2,1-3H3/t19-/m1/s1 |
| InChIKey | HWTSSYYMMVARTE-LJQANCHMSA-N |
| XLogP | 3.10 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|