C10H15NO5 — CID 134230679
2-ethoxycarbonyl-1,3-dimethyl-5-oxopyrrolidine-2-carboxylic acid (PubChem CID 134230679) has the molecular formula C10H15NO5 and a molecular weight of 229.23 g/mol. Its IUPAC name is 2-ethoxycarbonyl-1,3-dimethyl-5-oxopyrrolidine-2-carboxylic acid.
| Compound Name | 2-ethoxycarbonyl-1,3-dimethyl-5-oxopyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 134230679 |
| Molecular Formula | C10H15NO5 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 2-ethoxycarbonyl-1,3-dimethyl-5-oxopyrrolidine-2-carboxylic acid |
| SMILES | CCOC(=O)C1(C(=O)O)C(C)CC(=O)N1C |
| InChI | InChI=1S/C10H15NO5/c1-4-16-9(15)10(8(13)14)6(2)5-7(12)11(10)3/h6H,4-5H2,1-3H3,(H,13,14) |
| InChIKey | UWHWZPGJOJUPFK-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|