C12H19NO5 — CID 69351555
(2S)-1-acetyl-2-ethoxycarbonyl-3,3-dimethylpyrrolidine-2-carboxylic acid (PubChem CID 69351555) has the molecular formula C12H19NO5 and a molecular weight of 257.29 g/mol. Its IUPAC name is (2S)-1-acetyl-2-ethoxycarbonyl-3,3-dimethylpyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-acetyl-2-ethoxycarbonyl-3,3-dimethylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 69351555 |
| Molecular Formula | C12H19NO5 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | (2S)-1-acetyl-2-ethoxycarbonyl-3,3-dimethylpyrrolidine-2-carboxylic acid |
| SMILES | CCOC(=O)[C@]1(C(=O)O)N(C(C)=O)CCC1(C)C |
| InChI | InChI=1S/C12H19NO5/c1-5-18-10(17)12(9(15)16)11(3,4)6-7-13(12)8(2)14/h5-7H2,1-4H3,(H,15,16)/t12-/m0/s1 |
| InChIKey | HTCLOVSGBJLUMG-LBPRGKRZSA-N |
| XLogP | 0.65 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|