C13H22O4 — CID 135041560
diethyl 2,2-dimethylcyclopentane-1,1-dicarboxylate (PubChem CID 135041560) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is diethyl 2,2-dimethylcyclopentane-1,1-dicarboxylate.
| Compound Name | diethyl 2,2-dimethylcyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 135041560 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | diethyl 2,2-dimethylcyclopentane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CCCC1(C)C |
| InChI | InChI=1S/C13H22O4/c1-5-16-10(14)13(11(15)17-6-2)9-7-8-12(13,3)4/h5-9H2,1-4H3 |
| InChIKey | JQVYHKHYMFHCDN-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|