C20H27NO4 — CID 11439382
diethyl 1,4-dimethyl-6-phenyl-5,6-dihydro-2H-azepine-7,7-dicarboxylate (PubChem CID 11439382) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is diethyl 1,4-dimethyl-6-phenyl-5,6-dihydro-2H-azepine-7,7-dicarboxylate.
| Compound Name | diethyl 1,4-dimethyl-6-phenyl-5,6-dihydro-2H-azepine-7,7-dicarboxylate |
|---|---|
| PubChem CID | 11439382 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | diethyl 1,4-dimethyl-6-phenyl-5,6-dihydro-2H-azepine-7,7-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C(c2ccccc2)CC(C)=CCN1C |
| InChI | InChI=1S/C20H27NO4/c1-5-24-18(22)20(19(23)25-6-2)17(16-10-8-7-9-11-16)14-15(3)12-13-21(20)4/h7-12,17H,5-6,13-14H2,1-4H3 |
| InChIKey | GBJAZLPNFARWNK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|