C24H27NO4 — CID 70676111
2-O'-tert-butyl 2-O-ethyl 3,5-diphenyl-3,4-dihydropyrrole-2,2-dicarboxylate (PubChem CID 70676111) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is 2-O'-tert-butyl 2-O-ethyl 3,5-diphenyl-3,4-dihydropyrrole-2,2-dicarboxylate.
| Compound Name | 2-O'-tert-butyl 2-O-ethyl 3,5-diphenyl-3,4-dihydropyrrole-2,2-dicarboxylate |
|---|---|
| PubChem CID | 70676111 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 2-O'-tert-butyl 2-O-ethyl 3,5-diphenyl-3,4-dihydropyrrole-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OC(C)(C)C)N=C(c2ccccc2)CC1c1ccccc1 |
| InChI | InChI=1S/C24H27NO4/c1-5-28-21(26)24(22(27)29-23(2,3)4)19(17-12-8-6-9-13-17)16-20(25-24)18-14-10-7-11-15-18/h6-15,19H,5,16H2,1-4H3 |
| InChIKey | KOHAZRYZISSWEF-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|