C22H25NO4 — CID 70676422
diethyl (3S,5R)-3,5-diphenylpyrrolidine-2,2-dicarboxylate (PubChem CID 70676422) has the molecular formula C22H25NO4 and a molecular weight of 367.45 g/mol. Its IUPAC name is diethyl (3S,5R)-3,5-diphenylpyrrolidine-2,2-dicarboxylate.
| Compound Name | diethyl (3S,5R)-3,5-diphenylpyrrolidine-2,2-dicarboxylate |
|---|---|
| PubChem CID | 70676422 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | diethyl (3S,5R)-3,5-diphenylpyrrolidine-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)N[C@@H](c2ccccc2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H25NO4/c1-3-26-20(24)22(21(25)27-4-2)18(16-11-7-5-8-12-16)15-19(23-22)17-13-9-6-10-14-17/h5-14,18-19,23H,3-4,15H2,1-2H3/t18-,19+/m0/s1 |
| InChIKey | LNHMPWXOMMTJQF-RBUKOAKNSA-N |
| XLogP | 3.37 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|