C21H20N2O4 — CID 124923893
ethyl (2S,4R)-4-benzoyl-2-hydroxy-2-phenyl-1,7-diazabicyclo[4.1.0]hept-5-ene-5-carboxylate (PubChem CID 124923893) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is ethyl (2S,4R)-4-benzoyl-2-hydroxy-2-phenyl-1,7-diazabicyclo[4.1.0]hept-5-ene-5-carboxylate.
| Compound Name | ethyl (2S,4R)-4-benzoyl-2-hydroxy-2-phenyl-1,7-diazabicyclo[4.1.0]hept-5-ene-5-carboxylate |
|---|---|
| PubChem CID | 124923893 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | ethyl (2S,4R)-4-benzoyl-2-hydroxy-2-phenyl-1,7-diazabicyclo[4.1.0]hept-5-ene-5-carboxylate |
| SMILES | CCOC(=O)C1=C2NN2[C@@](O)(c2ccccc2)C[C@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C21H20N2O4/c1-2-27-20(25)17-16(18(24)14-9-5-3-6-10-14)13-21(26,23-19(17)22-23)15-11-7-4-8-12-15/h3-12,16,22,26H,2,13H2,1H3/t16-,21+,23?/m1/s1 |
| InChIKey | OMXDMONIZVZCRQ-FJEIIGRJSA-N |
| XLogP | 2.33 |
| TPSA | 88.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|