C23H31NO6 — CID 91927684
diethyl 2,4,6-trimethyl-1,4-dihydropyridine-3,5-dicarboxylate;ethyl benzoate (PubChem CID 91927684) has the molecular formula C23H31NO6 and a molecular weight of 417.50 g/mol. Its IUPAC name is diethyl 2,4,6-trimethyl-1,4-dihydropyridine-3,5-dicarboxylate;ethyl benzoate.
| Compound Name | diethyl 2,4,6-trimethyl-1,4-dihydropyridine-3,5-dicarboxylate;ethyl benzoate |
|---|---|
| PubChem CID | 91927684 |
| Molecular Formula | C23H31NO6 |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | diethyl 2,4,6-trimethyl-1,4-dihydropyridine-3,5-dicarboxylate;ethyl benzoate |
| SMILES | CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1C.CCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H21NO4.C9H10O2/c1-6-18-13(16)11-8(3)12(14(17)19-7-2)10(5)15-9(11)4;1-2-11-9(10)8-6-4-3-5-7-8/h8,15H,6-7H2,1-5H3;3-7H,2H2,1H3 |
| InChIKey | GFIMBBWOIRSHKD-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|