About ethyl 4-hydroxy-2-methyl-1,4-dihydroquinoline-3-carboxylate
ethyl 4-hydroxy-2-methyl-1,4-dihydroquinoline-3-carboxylate (PubChem CID 140989258) has the molecular formula C13H15NO3
and a molecular weight of 233.27 g/mol. Its IUPAC name is ethyl 4-hydroxy-2-methyl-1,4-dihydroquinoline-3-carboxylate.
Analyze ethyl 4-hydroxy-2-methyl-1,4-dihydroquinoline-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-hydroxy-2-methyl-1,4-dihydroquinoline-3-carboxylate?
The IUPAC name of ethyl 4-hydroxy-2-methyl-1,4-dihydroquinoline-3-carboxylate (CID 140989258) is ethyl 4-hydroxy-2-methyl-1,4-dihydroquinoline-3-carboxylate.
What is the SMILES notation for ethyl 4-hydroxy-2-methyl-1,4-dihydroquinoline-3-carboxylate?
The canonical SMILES for ethyl 4-hydroxy-2-methyl-1,4-dihydroquinoline-3-carboxylate is CCOC(=O)C1=C(C)Nc2ccccc2C1O.
What is the InChIKey of ethyl 4-hydroxy-2-methyl-1,4-dihydroquinoline-3-carboxylate?
The InChIKey is FVOZUPKMQYASCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO3/c1-3-17-13(16)11-8(2)14-10-7-5-4-6-9(10)12(11)15/h4-7,12,14-15H,3H2,1-2H3.
What are the key properties of ethyl 4-hydroxy-2-methyl-1,4-dihydroquinoline-3-carboxylate?
ethyl 4-hydroxy-2-methyl-1,4-dihydroquinoline-3-carboxylate has a molecular weight of 233.27 g/mol, XLogP of 1.98, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-hydroxy-2-methyl-1,4-dihydroquinoline-3-carboxylate is sourced from PubChem (CID 140989258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).