C23H27NO6 — CID 67904955
(Z)-3-[2-[3,5-bis(ethoxycarbonyl)-2,6-dimethyl-1,4-dihydropyridin-4-yl]phenyl]-2-methylprop-2-enoic acid (PubChem CID 67904955) has the molecular formula C23H27NO6 and a molecular weight of 413.47 g/mol. Its IUPAC name is (Z)-3-[2-[3,5-bis(ethoxycarbonyl)-2,6-dimethyl-1,4-dihydropyridin-4-yl]phenyl]-2-methylprop-2-enoic acid.
| Compound Name | (Z)-3-[2-[3,5-bis(ethoxycarbonyl)-2,6-dimethyl-1,4-dihydropyridin-4-yl]phenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 67904955 |
| Molecular Formula | C23H27NO6 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | (Z)-3-[2-[3,5-bis(ethoxycarbonyl)-2,6-dimethyl-1,4-dihydropyridin-4-yl]phenyl]-2-methylprop-2-enoic acid |
| SMILES | CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1c1ccccc1/C=C(/C)C(=O)O |
| InChI | InChI=1S/C23H27NO6/c1-6-29-22(27)18-14(4)24-15(5)19(23(28)30-7-2)20(18)17-11-9-8-10-16(17)12-13(3)21(25)26/h8-12,20,24H,6-7H2,1-5H3,(H,25,26)/b13-12- |
| InChIKey | UVIQIWYEEVDZLW-SEYXRHQNSA-N |
| XLogP | 3.54 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|