C25H29NO6 — CID 89379650
diethyl 3,6-dimethyl-4-[2-[(E)-3-oxo-3-prop-1-en-2-yloxyprop-1-enyl]phenyl]-1,4-dihydropyridine-2,5-dicarboxylate (PubChem CID 89379650) has the molecular formula C25H29NO6 and a molecular weight of 439.51 g/mol. Its IUPAC name is diethyl 3,6-dimethyl-4-[2-[(E)-3-oxo-3-prop-1-en-2-yloxyprop-1-enyl]phenyl]-1,4-dihydropyridine-2,5-dicarboxylate.
| Compound Name | diethyl 3,6-dimethyl-4-[2-[(E)-3-oxo-3-prop-1-en-2-yloxyprop-1-enyl]phenyl]-1,4-dihydropyridine-2,5-dicarboxylate |
|---|---|
| PubChem CID | 89379650 |
| Molecular Formula | C25H29NO6 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | diethyl 3,6-dimethyl-4-[2-[(E)-3-oxo-3-prop-1-en-2-yloxyprop-1-enyl]phenyl]-1,4-dihydropyridine-2,5-dicarboxylate |
| SMILES | C=C(C)OC(=O)/C=C/c1ccccc1C1C(C)=C(C(=O)OCC)NC(C)=C1C(=O)OCC |
| InChI | InChI=1S/C25H29NO6/c1-7-30-24(28)22-17(6)26-23(25(29)31-8-2)16(5)21(22)19-12-10-9-11-18(19)13-14-20(27)32-15(3)4/h9-14,21,26H,3,7-8H2,1-2,4-6H3/b14-13+ |
| InChIKey | ZBVZGJXHFDCRQK-BUHFOSPRSA-N |
| XLogP | 4.14 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|