C30H28ClNO6 — CID 44614889
bis(prop-2-enyl) 4-[4-[(E)-3-(2-chlorophenyl)prop-2-enoyl]oxyphenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 44614889) has the molecular formula C30H28ClNO6 and a molecular weight of 534.01 g/mol. Its IUPAC name is bis(prop-2-enyl) 4-[4-[(E)-3-(2-chlorophenyl)prop-2-enoyl]oxyphenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | bis(prop-2-enyl) 4-[4-[(E)-3-(2-chlorophenyl)prop-2-enoyl]oxyphenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 44614889 |
| Molecular Formula | C30H28ClNO6 |
| Molecular Weight | 534.01 g/mol |
| Exact Mass | 533.16 |
| IUPAC Name | bis(prop-2-enyl) 4-[4-[(E)-3-(2-chlorophenyl)prop-2-enoyl]oxyphenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | C=CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC=C)C1c1ccc(OC(=O)/C=C/c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C30H28ClNO6/c1-5-17-36-29(34)26-19(3)32-20(4)27(30(35)37-18-6-2)28(26)22-11-14-23(15-12-22)38-25(33)16-13-21-9-7-8-10-24(21)31/h5-16,28,32H,1-2,17-18H2,3-4H3/b16-13+ |
| InChIKey | OXKVOLQXEBORBX-DTQAZKPQSA-N |
| XLogP | 5.65 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.01 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|