C28H39ClN2O6 — CID 14208988
diethyl 2-methyl-6-(methylaminomethyl)-4-[2-[(E)-2-propoxycarbonylbut-1-enyl]phenyl]-1,4-dihydropyridine-3,5-dicarboxylate;hydrochloride (PubChem CID 14208988) has the molecular formula C28H39ClN2O6 and a molecular weight of 535.08 g/mol. Its IUPAC name is diethyl 2-methyl-6-(methylaminomethyl)-4-[2-[(E)-2-propoxycarbonylbut-1-enyl]phenyl]-1,4-dihydropyridine-3,5-dicarboxylate;hydrochloride.
| Compound Name | diethyl 2-methyl-6-(methylaminomethyl)-4-[2-[(E)-2-propoxycarbonylbut-1-enyl]phenyl]-1,4-dihydropyridine-3,5-dicarboxylate;hydrochloride |
|---|---|
| PubChem CID | 14208988 |
| Molecular Formula | C28H39ClN2O6 |
| Molecular Weight | 535.08 g/mol |
| Exact Mass | 534.25 |
| IUPAC Name | diethyl 2-methyl-6-(methylaminomethyl)-4-[2-[(E)-2-propoxycarbonylbut-1-enyl]phenyl]-1,4-dihydropyridine-3,5-dicarboxylate;hydrochloride |
| SMILES | CCCOC(=O)/C(=C/c1ccccc1C1C(C(=O)OCC)=C(C)NC(CNC)=C1C(=O)OCC)CC.Cl |
| InChI | InChI=1S/C28H38N2O6.ClH/c1-7-15-36-26(31)19(8-2)16-20-13-11-12-14-21(20)24-23(27(32)34-9-3)18(5)30-22(17-29-6)25(24)28(33)35-10-4;/h11-14,16,24,29-30H,7-10,15,17H2,1-6H3;1H/b19-16+; |
| InChIKey | YDLONTIFVNCUDG-PXMDEAMVSA-N |
| XLogP | 4.42 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.08 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|