C30H43ClN2O6 — CID 139644773
diethyl 2-[(dimethylamino)methyl]-6-methyl-4-[2-[(E)-2-methyl-3-oxo-3-pentoxyprop-1-enyl]phenyl]-1,4-dihydropyridine-3,5-dicarboxylate;hydrochloride (PubChem CID 139644773) has the molecular formula C30H43ClN2O6 and a molecular weight of 563.14 g/mol. Its IUPAC name is diethyl 2-[(dimethylamino)methyl]-6-methyl-4-[2-[(E)-2-methyl-3-oxo-3-pentoxyprop-1-enyl]phenyl]-1,4-dihydropyridine-3,5-dicarboxylate;hydrochloride.
| Compound Name | diethyl 2-[(dimethylamino)methyl]-6-methyl-4-[2-[(E)-2-methyl-3-oxo-3-pentoxyprop-1-enyl]phenyl]-1,4-dihydropyridine-3,5-dicarboxylate;hydrochloride |
|---|---|
| PubChem CID | 139644773 |
| Molecular Formula | C30H43ClN2O6 |
| Molecular Weight | 563.14 g/mol |
| Exact Mass | 562.28 |
| IUPAC Name | diethyl 2-[(dimethylamino)methyl]-6-methyl-4-[2-[(E)-2-methyl-3-oxo-3-pentoxyprop-1-enyl]phenyl]-1,4-dihydropyridine-3,5-dicarboxylate;hydrochloride |
| SMILES | CCCCCOC(=O)/C(C)=C/c1ccccc1C1C(C(=O)OCC)=C(C)NC(CN(C)C)=C1C(=O)OCC.Cl |
| InChI | InChI=1S/C30H42N2O6.ClH/c1-8-11-14-17-38-28(33)20(4)18-22-15-12-13-16-23(22)26-25(29(34)36-9-2)21(5)31-24(19-32(6)7)27(26)30(35)37-10-3;/h12-13,15-16,18,26,31H,8-11,14,17,19H2,1-7H3;1H/b20-18+; |
| InChIKey | FAPGBXQDRPZXPH-KPJFUTMLSA-N |
| XLogP | 5.15 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.14 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|