C20H27N3O5 — CID 143774748
3-O-ethyl 5-O-methyl 2-(2-aminoethoxymethyl)-4-(2-aminophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 143774748) has the molecular formula C20H27N3O5 and a molecular weight of 389.45 g/mol. Its IUPAC name is 3-O-ethyl 5-O-methyl 2-(2-aminoethoxymethyl)-4-(2-aminophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-ethyl 5-O-methyl 2-(2-aminoethoxymethyl)-4-(2-aminophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 143774748 |
| Molecular Formula | C20H27N3O5 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 3-O-ethyl 5-O-methyl 2-(2-aminoethoxymethyl)-4-(2-aminophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(COCCN)NC(C)=C(C(=O)OC)C1c1ccccc1N |
| InChI | InChI=1S/C20H27N3O5/c1-4-28-20(25)18-15(11-27-10-9-21)23-12(2)16(19(24)26-3)17(18)13-7-5-6-8-14(13)22/h5-8,17,23H,4,9-11,21-22H2,1-3H3 |
| InChIKey | ABYWLHNLLAVNJV-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 125.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|