C28H32N4O4 — CID 11973529
diethyl (4E,15E)-3,5,14,16-tetramethyl-2,6,13,17-tetrazatricyclo[16.4.0.07,12]docosa-1(22),2,4,7,9,11,13,15,18,20-decaene-4,15-dicarboxylate (PubChem CID 11973529) has the molecular formula C28H32N4O4 and a molecular weight of 488.59 g/mol. Its IUPAC name is diethyl (4E,15E)-3,5,14,16-tetramethyl-2,6,13,17-tetrazatricyclo[16.4.0.07,12]docosa-1(22),2,4,7,9,11,13,15,18,20-decaene-4,15-dicarboxylate.
| Compound Name | diethyl (4E,15E)-3,5,14,16-tetramethyl-2,6,13,17-tetrazatricyclo[16.4.0.07,12]docosa-1(22),2,4,7,9,11,13,15,18,20-decaene-4,15-dicarboxylate |
|---|---|
| PubChem CID | 11973529 |
| Molecular Formula | C28H32N4O4 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | diethyl (4E,15E)-3,5,14,16-tetramethyl-2,6,13,17-tetrazatricyclo[16.4.0.07,12]docosa-1(22),2,4,7,9,11,13,15,18,20-decaene-4,15-dicarboxylate |
| SMILES | CCOC(=O)C1=C(\C)Nc2ccccc2/N=C(C)/C(C(=O)OCC)=C(/C)Nc2ccccc2\N=C\1C |
| InChI | InChI=1S/C28H32N4O4/c1-7-35-27(33)25-17(3)29-21-13-9-11-15-23(21)31-19(5)26(28(34)36-8-2)20(6)32-24-16-12-10-14-22(24)30-18(25)4/h9-16,29,32H,7-8H2,1-6H3/b25-17+,26-20+,30-18+,31-19+ |
| InChIKey | MVPVIYUZGHMLMS-LKXADPRSSA-N |
| XLogP | 6.08 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |