C36H32N4O2 — CID 11973138
[(4E,15E)-15-benzoyl-3,5,14,16-tetramethyl-2,6,13,17-tetrazatricyclo[16.4.0.07,12]docosa-1(22),2,4,7,9,11,13,15,18,20-decaen-4-yl]-phenylmethanone (PubChem CID 11973138) has the molecular formula C36H32N4O2 and a molecular weight of 552.68 g/mol. Its IUPAC name is [(4E,15E)-15-benzoyl-3,5,14,16-tetramethyl-2,6,13,17-tetrazatricyclo[16.4.0.07,12]docosa-1(22),2,4,7,9,11,13,15,18,20-decaen-4-yl]-phenylmethanone.
| Compound Name | [(4E,15E)-15-benzoyl-3,5,14,16-tetramethyl-2,6,13,17-tetrazatricyclo[16.4.0.07,12]docosa-1(22),2,4,7,9,11,13,15,18,20-decaen-4-yl]-phenylmethanone |
|---|---|
| PubChem CID | 11973138 |
| Molecular Formula | C36H32N4O2 |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.25 |
| IUPAC Name | [(4E,15E)-15-benzoyl-3,5,14,16-tetramethyl-2,6,13,17-tetrazatricyclo[16.4.0.07,12]docosa-1(22),2,4,7,9,11,13,15,18,20-decaen-4-yl]-phenylmethanone |
| SMILES | CC1=N\c2ccccc2N/C(C)=C(C(=O)c2ccccc2)\C(C)=N\c2ccccc2N/C(C)=C\1C(=O)c1ccccc1 |
| InChI | InChI=1S/C36H32N4O2/c1-23-33(35(41)27-15-7-5-8-16-27)24(2)38-31-21-13-14-22-32(31)40-26(4)34(36(42)28-17-9-6-10-18-28)25(3)39-30-20-12-11-19-29(30)37-23/h5-22,37,40H,1-4H3/b33-23+,34-26+,38-24+,39-25+ |
| InChIKey | OBNYODPIXMIWLU-UIKMFLEDSA-N |
| XLogP | 8.72 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |