C29H28N2O5 — CID 23944553
ethyl 4-[3-[(2-methylbenzoyl)-[(4-methylphenyl)methyl]amino]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 23944553) has the molecular formula C29H28N2O5 and a molecular weight of 484.55 g/mol. Its IUPAC name is ethyl 4-[3-[(2-methylbenzoyl)-[(4-methylphenyl)methyl]amino]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[3-[(2-methylbenzoyl)-[(4-methylphenyl)methyl]amino]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 23944553 |
| Molecular Formula | C29H28N2O5 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | ethyl 4-[3-[(2-methylbenzoyl)-[(4-methylphenyl)methyl]amino]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)CC(N(Cc3ccc(C)cc3)C(=O)c3ccccc3C)C2=O)cc1 |
| InChI | InChI=1S/C29H28N2O5/c1-4-36-29(35)22-13-15-23(16-14-22)31-26(32)17-25(28(31)34)30(18-21-11-9-19(2)10-12-21)27(33)24-8-6-5-7-20(24)3/h5-16,25H,4,17-18H2,1-3H3 |
| InChIKey | FURSEHJXSONLJU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|