C27H23F2N3O5 — CID 92656705
ethyl 4-[(3S)-3-[(4-fluorophenyl)carbamoyl-[(4-fluorophenyl)methyl]amino]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 92656705) has the molecular formula C27H23F2N3O5 and a molecular weight of 507.49 g/mol. Its IUPAC name is ethyl 4-[(3S)-3-[(4-fluorophenyl)carbamoyl-[(4-fluorophenyl)methyl]amino]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[(3S)-3-[(4-fluorophenyl)carbamoyl-[(4-fluorophenyl)methyl]amino]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 92656705 |
| Molecular Formula | C27H23F2N3O5 |
| Molecular Weight | 507.49 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | ethyl 4-[(3S)-3-[(4-fluorophenyl)carbamoyl-[(4-fluorophenyl)methyl]amino]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C[C@H](N(Cc3ccc(F)cc3)C(=O)Nc3ccc(F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C27H23F2N3O5/c1-2-37-26(35)18-5-13-22(14-6-18)32-24(33)15-23(25(32)34)31(16-17-3-7-19(28)8-4-17)27(36)30-21-11-9-20(29)10-12-21/h3-14,23H,2,15-16H2,1H3,(H,30,36)/t23-/m0/s1 |
| InChIKey | UNWINEMNSICCRZ-QHCPKHFHSA-N |
| XLogP | 4.51 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.49 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|