C19H24O3 — CID 135068416
ethyl (1S,3aR,6aR)-2-benzoyl-1-methyl-3,3a,4,5,6,6a-hexahydro-2H-pentalene-1-carboxylate (PubChem CID 135068416) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is ethyl (1S,3aR,6aR)-2-benzoyl-1-methyl-3,3a,4,5,6,6a-hexahydro-2H-pentalene-1-carboxylate.
| Compound Name | ethyl (1S,3aR,6aR)-2-benzoyl-1-methyl-3,3a,4,5,6,6a-hexahydro-2H-pentalene-1-carboxylate |
|---|---|
| PubChem CID | 135068416 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | ethyl (1S,3aR,6aR)-2-benzoyl-1-methyl-3,3a,4,5,6,6a-hexahydro-2H-pentalene-1-carboxylate |
| SMILES | CCOC(=O)[C@]1(C)C(C(=O)c2ccccc2)C[C@H]2CCC[C@H]21 |
| InChI | InChI=1S/C19H24O3/c1-3-22-18(21)19(2)15-11-7-10-14(15)12-16(19)17(20)13-8-5-4-6-9-13/h4-6,8-9,14-16H,3,7,10-12H2,1-2H3/t14-,15-,16?,19+/m1/s1 |
| InChIKey | HHCLNMOGNCIGAL-QUGVFXFJSA-N |
| XLogP | 3.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |