C25H31NO2 — CID 135014180
ethyl (2R,3R)-1-benzhydryl-3-cyclohexyl-2-methylaziridine-2-carboxylate (PubChem CID 135014180) has the molecular formula C25H31NO2 and a molecular weight of 377.53 g/mol. Its IUPAC name is ethyl (2R,3R)-1-benzhydryl-3-cyclohexyl-2-methylaziridine-2-carboxylate.
| Compound Name | ethyl (2R,3R)-1-benzhydryl-3-cyclohexyl-2-methylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 135014180 |
| Molecular Formula | C25H31NO2 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.24 |
| IUPAC Name | ethyl (2R,3R)-1-benzhydryl-3-cyclohexyl-2-methylaziridine-2-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C)[C@@H](C2CCCCC2)N1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H31NO2/c1-3-28-24(27)25(2)23(21-17-11-6-12-18-21)26(25)22(19-13-7-4-8-14-19)20-15-9-5-10-16-20/h4-5,7-10,13-16,21-23H,3,6,11-12,17-18H2,1-2H3/t23-,25-,26?/m1/s1 |
| InChIKey | BGDLOFZNKFEOJR-VVTDDVKJSA-N |
| XLogP | 5.36 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|