About ethyl (3R)-1,3-dihydroxy-2-[(1S)-1-phenylethyl]-2-azabicyclo[2.2.2]octane-3-carboxylate
ethyl (3R)-1,3-dihydroxy-2-[(1S)-1-phenylethyl]-2-azabicyclo[2.2.2]octane-3-carboxylate (PubChem CID 69018663) has the molecular formula C18H25NO4
and a molecular weight of 319.40 g/mol. Its IUPAC name is ethyl (3R)-1,3-dihydroxy-2-[(1S)-1-phenylethyl]-2-azabicyclo[2.2.2]octane-3-carboxylate.
Molecular Properties
| Compound Name | ethyl (3R)-1,3-dihydroxy-2-[(1S)-1-phenylethyl]-2-azabicyclo[2.2.2]octane-3-carboxylate |
| PubChem CID | 69018663 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | ethyl (3R)-1,3-dihydroxy-2-[(1S)-1-phenylethyl]-2-azabicyclo[2.2.2]octane-3-carboxylate |
| SMILES | CCOC(=O)[C@]1(O)C2CCC(O)(CC2)N1[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C18H25NO4/c1-3-23-16(20)18(22)15-9-11-17(21,12-10-15)19(18)13(2)14-7-5-4-6-8-14/h4-8,13,15,21-22H,3,9-12H2,1-2H3/t13-,15?,17?,18+/m0/s1 |
| InChIKey | MQHRKMOACZMHNM-SMRZUVACSA-N |
| XLogP | 2.19 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl (3R)-1,3-dihydroxy-2-[(1S)-1-phenylethyl]-2-azabicyclo[2.2.2]octane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (3R)-1,3-dihydroxy-2-[(1S)-1-phenylethyl]-2-azabicyclo[2.2.2]octane-3-carboxylate?
The IUPAC name of ethyl (3R)-1,3-dihydroxy-2-[(1S)-1-phenylethyl]-2-azabicyclo[2.2.2]octane-3-carboxylate (CID 69018663) is ethyl (3R)-1,3-dihydroxy-2-[(1S)-1-phenylethyl]-2-azabicyclo[2.2.2]octane-3-carboxylate.
What is the SMILES notation for ethyl (3R)-1,3-dihydroxy-2-[(1S)-1-phenylethyl]-2-azabicyclo[2.2.2]octane-3-carboxylate?
The canonical SMILES for ethyl (3R)-1,3-dihydroxy-2-[(1S)-1-phenylethyl]-2-azabicyclo[2.2.2]octane-3-carboxylate is CCOC(=O)[C@]1(O)C2CCC(O)(CC2)N1[C@@H](C)c1ccccc1.
What is the InChIKey of ethyl (3R)-1,3-dihydroxy-2-[(1S)-1-phenylethyl]-2-azabicyclo[2.2.2]octane-3-carboxylate?
The InChIKey is MQHRKMOACZMHNM-SMRZUVACSA-N. The full InChI is InChI=1S/C18H25NO4/c1-3-23-16(20)18(22)15-9-11-17(21,12-10-15)19(18)13(2)14-7-5-4-6-8-14/h4-8,13,15,21-22H,3,9-12H2,1-2H3/t13-,15?,17?,18+/m0/s1.
What are the key properties of ethyl (3R)-1,3-dihydroxy-2-[(1S)-1-phenylethyl]-2-azabicyclo[2.2.2]octane-3-carboxylate?
ethyl (3R)-1,3-dihydroxy-2-[(1S)-1-phenylethyl]-2-azabicyclo[2.2.2]octane-3-carboxylate has a molecular weight of 319.40 g/mol, XLogP of 2.19, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (3R)-1,3-dihydroxy-2-[(1S)-1-phenylethyl]-2-azabicyclo[2.2.2]octane-3-carboxylate is sourced from PubChem (CID 69018663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).