C23H31NO3 — CID 102351359
ethyl (1R,6S,7R)-6-hydroxy-9-[(1S)-1-phenylethyl]-9-azatricyclo[5.3.3.01,6]tridec-3-ene-7-carboxylate (PubChem CID 102351359) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is ethyl (1R,6S,7R)-6-hydroxy-9-[(1S)-1-phenylethyl]-9-azatricyclo[5.3.3.01,6]tridec-3-ene-7-carboxylate.
| Compound Name | ethyl (1R,6S,7R)-6-hydroxy-9-[(1S)-1-phenylethyl]-9-azatricyclo[5.3.3.01,6]tridec-3-ene-7-carboxylate |
|---|---|
| PubChem CID | 102351359 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | ethyl (1R,6S,7R)-6-hydroxy-9-[(1S)-1-phenylethyl]-9-azatricyclo[5.3.3.01,6]tridec-3-ene-7-carboxylate |
| SMILES | CCOC(=O)[C@@]12CCC[C@@]3(CC=CC[C@]31O)CN([C@@H](C)c1ccccc1)C2 |
| InChI | InChI=1S/C23H31NO3/c1-3-27-20(25)22-14-9-13-21(12-7-8-15-23(21,22)26)16-24(17-22)18(2)19-10-5-4-6-11-19/h4-8,10-11,18,26H,3,9,12-17H2,1-2H3/t18-,21-,22-,23-/m0/s1 |
| InChIKey | GGOXPOUDTVAPSV-QGQQZZQASA-N |
| XLogP | 3.86 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|