C31H29NO3 — CID 11719618
ethyl (2S,3R)-1-benzhydryl-2-[hydroxy(phenyl)methyl]-3-phenylaziridine-2-carboxylate (PubChem CID 11719618) has the molecular formula C31H29NO3 and a molecular weight of 463.58 g/mol. Its IUPAC name is ethyl (2S,3R)-1-benzhydryl-2-[hydroxy(phenyl)methyl]-3-phenylaziridine-2-carboxylate.
| Compound Name | ethyl (2S,3R)-1-benzhydryl-2-[hydroxy(phenyl)methyl]-3-phenylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 11719618 |
| Molecular Formula | C31H29NO3 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | ethyl (2S,3R)-1-benzhydryl-2-[hydroxy(phenyl)methyl]-3-phenylaziridine-2-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C(O)c2ccccc2)[C@@H](c2ccccc2)N1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H29NO3/c1-2-35-30(34)31(29(33)26-21-13-6-14-22-26)28(25-19-11-5-12-20-25)32(31)27(23-15-7-3-8-16-23)24-17-9-4-10-18-24/h3-22,27-29,33H,2H2,1H3/t28-,29?,31+,32?/m1/s1 |
| InChIKey | RARRIPFWXMCXLH-LIYJXANGSA-N |
| XLogP | 5.87 |
| TPSA | 49.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|