C25H29NO5 — CID 102320155
ethyl 3-[(3R,4R)-3-[(2S,3R)-3-ethyloxiran-2-yl]-3-[(S)-hydroxy(phenyl)methyl]-2-oxo-4-phenylazetidin-1-yl]propanoate (PubChem CID 102320155) has the molecular formula C25H29NO5 and a molecular weight of 423.51 g/mol. Its IUPAC name is ethyl 3-[(3R,4R)-3-[(2S,3R)-3-ethyloxiran-2-yl]-3-[(S)-hydroxy(phenyl)methyl]-2-oxo-4-phenylazetidin-1-yl]propanoate.
| Compound Name | ethyl 3-[(3R,4R)-3-[(2S,3R)-3-ethyloxiran-2-yl]-3-[(S)-hydroxy(phenyl)methyl]-2-oxo-4-phenylazetidin-1-yl]propanoate |
|---|---|
| PubChem CID | 102320155 |
| Molecular Formula | C25H29NO5 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | ethyl 3-[(3R,4R)-3-[(2S,3R)-3-ethyloxiran-2-yl]-3-[(S)-hydroxy(phenyl)methyl]-2-oxo-4-phenylazetidin-1-yl]propanoate |
| SMILES | CCOC(=O)CCN1C(=O)[C@@]([C@@H]2O[C@@H]2CC)([C@@H](O)c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C25H29NO5/c1-3-19-23(31-19)25(22(28)18-13-9-6-10-14-18)21(17-11-7-5-8-12-17)26(24(25)29)16-15-20(27)30-4-2/h5-14,19,21-23,28H,3-4,15-16H2,1-2H3/t19-,21-,22+,23-,25-/m1/s1 |
| InChIKey | UJEXBGCXEQFFIF-FGBFUVBKSA-N |
| XLogP | 3.42 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|