C19H23ClO2S — CID 52916151
S-ethyl (1S,2S,3aR,6aR)-2-(4-chlorobenzoyl)-1-methyl-3,3a,4,5,6,6a-hexahydro-2H-pentalene-1-carbothioate (PubChem CID 52916151) has the molecular formula C19H23ClO2S and a molecular weight of 350.91 g/mol. Its IUPAC name is S-ethyl (1S,2S,3aR,6aR)-2-(4-chlorobenzoyl)-1-methyl-3,3a,4,5,6,6a-hexahydro-2H-pentalene-1-carbothioate.
| Compound Name | S-ethyl (1S,2S,3aR,6aR)-2-(4-chlorobenzoyl)-1-methyl-3,3a,4,5,6,6a-hexahydro-2H-pentalene-1-carbothioate |
|---|---|
| PubChem CID | 52916151 |
| Molecular Formula | C19H23ClO2S |
| Molecular Weight | 350.91 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | S-ethyl (1S,2S,3aR,6aR)-2-(4-chlorobenzoyl)-1-methyl-3,3a,4,5,6,6a-hexahydro-2H-pentalene-1-carbothioate |
| SMILES | CCSC(=O)[C@]1(C)[C@@H](C(=O)c2ccc(Cl)cc2)C[C@H]2CCC[C@H]21 |
| InChI | InChI=1S/C19H23ClO2S/c1-3-23-18(22)19(2)15-6-4-5-13(15)11-16(19)17(21)12-7-9-14(20)10-8-12/h7-10,13,15-16H,3-6,11H2,1-2H3/t13-,15-,16-,19+/m1/s1 |
| InChIKey | XYCLTQAOWLDKPQ-ZIGSKRJUSA-N |
| XLogP | 5.24 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.91 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|