C24H28N2O5 — CID 177394633
diethyl 5-anilino-1-benzyl-2-oxopiperidine-4,4-dicarboxylate (PubChem CID 177394633) has the molecular formula C24H28N2O5 and a molecular weight of 424.50 g/mol. Its IUPAC name is diethyl 5-anilino-1-benzyl-2-oxopiperidine-4,4-dicarboxylate.
| Compound Name | diethyl 5-anilino-1-benzyl-2-oxopiperidine-4,4-dicarboxylate |
|---|---|
| PubChem CID | 177394633 |
| Molecular Formula | C24H28N2O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | diethyl 5-anilino-1-benzyl-2-oxopiperidine-4,4-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC(=O)N(Cc2ccccc2)CC1Nc1ccccc1 |
| InChI | InChI=1S/C24H28N2O5/c1-3-30-22(28)24(23(29)31-4-2)15-21(27)26(16-18-11-7-5-8-12-18)17-20(24)25-19-13-9-6-10-14-19/h5-14,20,25H,3-4,15-17H2,1-2H3 |
| InChIKey | BQKYTGYNTBMUSP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|