C20H26FNO5 — CID 19822492
diethyl 1-[(4-fluorophenyl)methyl]-5-oxo-3-propan-2-ylpyrrolidine-2,2-dicarboxylate (PubChem CID 19822492) has the molecular formula C20H26FNO5 and a molecular weight of 379.43 g/mol. Its IUPAC name is diethyl 1-[(4-fluorophenyl)methyl]-5-oxo-3-propan-2-ylpyrrolidine-2,2-dicarboxylate.
| Compound Name | diethyl 1-[(4-fluorophenyl)methyl]-5-oxo-3-propan-2-ylpyrrolidine-2,2-dicarboxylate |
|---|---|
| PubChem CID | 19822492 |
| Molecular Formula | C20H26FNO5 |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | diethyl 1-[(4-fluorophenyl)methyl]-5-oxo-3-propan-2-ylpyrrolidine-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C(C(C)C)CC(=O)N1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C20H26FNO5/c1-5-26-18(24)20(19(25)27-6-2)16(13(3)4)11-17(23)22(20)12-14-7-9-15(21)10-8-14/h7-10,13,16H,5-6,11-12H2,1-4H3 |
| InChIKey | LWCWSOMPKYFXMS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|