C19H27FN2O4S — CID 97378737
ethyl (3aS,8aR)-5-[(4-fluorophenyl)methyl]-2-methylsulfonyl-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate (PubChem CID 97378737) has the molecular formula C19H27FN2O4S and a molecular weight of 398.50 g/mol. Its IUPAC name is ethyl (3aS,8aR)-5-[(4-fluorophenyl)methyl]-2-methylsulfonyl-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate.
| Compound Name | ethyl (3aS,8aR)-5-[(4-fluorophenyl)methyl]-2-methylsulfonyl-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate |
|---|---|
| PubChem CID | 97378737 |
| Molecular Formula | C19H27FN2O4S |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | ethyl (3aS,8aR)-5-[(4-fluorophenyl)methyl]-2-methylsulfonyl-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate |
| SMILES | CCOC(=O)[C@]12CCCN(Cc3ccc(F)cc3)C[C@H]1CN(S(C)(=O)=O)C2 |
| InChI | InChI=1S/C19H27FN2O4S/c1-3-26-18(23)19-9-4-10-21(11-15-5-7-17(20)8-6-15)12-16(19)13-22(14-19)27(2,24)25/h5-8,16H,3-4,9-14H2,1-2H3/t16-,19-/m0/s1 |
| InChIKey | SRKSQULOEMPANW-LPHOPBHVSA-N |
| XLogP | 1.86 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |