C19H27F3N2O7S — CID 127021611
ethyl (3aS,8aR)-5-(furan-2-ylmethyl)-2-methylsulfonyl-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 127021611) has the molecular formula C19H27F3N2O7S and a molecular weight of 484.49 g/mol. Its IUPAC name is ethyl (3aS,8aR)-5-(furan-2-ylmethyl)-2-methylsulfonyl-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | ethyl (3aS,8aR)-5-(furan-2-ylmethyl)-2-methylsulfonyl-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127021611 |
| Molecular Formula | C19H27F3N2O7S |
| Molecular Weight | 484.49 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | ethyl (3aS,8aR)-5-(furan-2-ylmethyl)-2-methylsulfonyl-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | CCOC(=O)[C@]12CCCN(Cc3ccco3)C[C@H]1CN(S(C)(=O)=O)C2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H26N2O5S.C2HF3O2/c1-3-23-16(20)17-7-5-8-18(12-15-6-4-9-24-15)10-14(17)11-19(13-17)25(2,21)22;3-2(4,5)1(6)7/h4,6,9,14H,3,5,7-8,10-13H2,1-2H3;(H,6,7)/t14-,17-;/m0./s1 |
| InChIKey | UEBOJPKRKCKPAW-RVXRQPKJSA-N |
| XLogP | 1.95 |
| TPSA | 117.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.49 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |