C22H29N3O3 — CID 97378785
ethyl (3aS,8aR)-5-[(5-methylfuran-2-yl)methyl]-2-pyridin-2-yl-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate (PubChem CID 97378785) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is ethyl (3aS,8aR)-5-[(5-methylfuran-2-yl)methyl]-2-pyridin-2-yl-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate.
| Compound Name | ethyl (3aS,8aR)-5-[(5-methylfuran-2-yl)methyl]-2-pyridin-2-yl-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate |
|---|---|
| PubChem CID | 97378785 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | ethyl (3aS,8aR)-5-[(5-methylfuran-2-yl)methyl]-2-pyridin-2-yl-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate |
| SMILES | CCOC(=O)[C@]12CCCN(Cc3ccc(C)o3)C[C@H]1CN(c1ccccn1)C2 |
| InChI | InChI=1S/C22H29N3O3/c1-3-27-21(26)22-10-6-12-24(15-19-9-8-17(2)28-19)13-18(22)14-25(16-22)20-7-4-5-11-23-20/h4-5,7-9,11,18H,3,6,10,12-16H2,1-2H3/t18-,22-/m0/s1 |
| InChIKey | NEVDMGFACRCLHJ-AVRDEDQJSA-N |
| XLogP | 3.26 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |