C18H28N4O3S — CID 124809665
(3aS,8aS)-5-ethylsulfonyl-N,N-dimethyl-2-pyridin-2-yl-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxamide (PubChem CID 124809665) has the molecular formula C18H28N4O3S and a molecular weight of 380.51 g/mol. Its IUPAC name is (3aS,8aS)-5-ethylsulfonyl-N,N-dimethyl-2-pyridin-2-yl-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxamide.
| Compound Name | (3aS,8aS)-5-ethylsulfonyl-N,N-dimethyl-2-pyridin-2-yl-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxamide |
|---|---|
| PubChem CID | 124809665 |
| Molecular Formula | C18H28N4O3S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | (3aS,8aS)-5-ethylsulfonyl-N,N-dimethyl-2-pyridin-2-yl-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxamide |
| SMILES | CCS(=O)(=O)N1CCC[C@@]2(C(=O)N(C)C)CN(c3ccccn3)C[C@H]2C1 |
| InChI | InChI=1S/C18H28N4O3S/c1-4-26(24,25)22-11-7-9-18(17(23)20(2)3)14-21(12-15(18)13-22)16-8-5-6-10-19-16/h5-6,8,10,15H,4,7,9,11-14H2,1-3H3/t15-,18+/m0/s1 |
| InChIKey | SZJSIRZBITWCMB-MAUKXSAKSA-N |
| XLogP | 1.04 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |