C19H27F3N4O6S — CID 155845369
ethyl (3aR,8aR)-5-ethylsulfonyl-2-pyrimidin-2-yl-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 155845369) has the molecular formula C19H27F3N4O6S and a molecular weight of 496.51 g/mol. Its IUPAC name is ethyl (3aR,8aR)-5-ethylsulfonyl-2-pyrimidin-2-yl-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | ethyl (3aR,8aR)-5-ethylsulfonyl-2-pyrimidin-2-yl-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155845369 |
| Molecular Formula | C19H27F3N4O6S |
| Molecular Weight | 496.51 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | ethyl (3aR,8aR)-5-ethylsulfonyl-2-pyrimidin-2-yl-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | CCOC(=O)[C@]12CCCN(S(=O)(=O)CC)C[C@H]1CN(c1ncccn1)C2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H26N4O4S.C2HF3O2/c1-3-25-15(22)17-7-5-10-21(26(23,24)4-2)12-14(17)11-20(13-17)16-18-8-6-9-19-16;3-2(4,5)1(6)7/h6,8-9,14H,3-5,7,10-13H2,1-2H3;(H,6,7)/t14-,17+;/m1./s1 |
| InChIKey | PHGSCWZZLYYGLB-CVLQQERVSA-N |
| XLogP | 1.54 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.51 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |